C25H29ClN2O3S — CID 17356742
3-chloro-N'-[2-(2,4-ditert-butylphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 17356742) has the molecular formula C25H29ClN2O3S and a molecular weight of 473.04 g/mol. Its IUPAC name is 3-chloro-N'-[2-(2,4-ditert-butylphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[2-(2,4-ditert-butylphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 17356742 |
| Molecular Formula | C25H29ClN2O3S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 3-chloro-N'-[2-(2,4-ditert-butylphenoxy)acetyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)c2sc3ccccc3c2Cl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H29ClN2O3S/c1-24(2,3)15-11-12-18(17(13-15)25(4,5)6)31-14-20(29)27-28-23(30)22-21(26)16-9-7-8-10-19(16)32-22/h7-13H,14H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | HUFCVQONKBXKGY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|