C19H15ClN2O3S — CID 5109357
3-chloro-N'-[3-(2-methoxyphenyl)prop-2-enoyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 5109357) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is 3-chloro-N'-[3-(2-methoxyphenyl)prop-2-enoyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[3-(2-methoxyphenyl)prop-2-enoyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 5109357 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-chloro-N'-[3-(2-methoxyphenyl)prop-2-enoyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccccc1C=CC(=O)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C19H15ClN2O3S/c1-25-14-8-4-2-6-12(14)10-11-16(23)21-22-19(24)18-17(20)13-7-3-5-9-15(13)26-18/h2-11H,1H3,(H,21,23)(H,22,24) |
| InChIKey | YOPQMAHCIHHWEC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|