C22H15ClN2O2S — CID 6297669
3-chloro-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 6297669) has the molecular formula C22H15ClN2O2S and a molecular weight of 406.89 g/mol. Its IUPAC name is 3-chloro-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 6297669 |
| Molecular Formula | C22H15ClN2O2S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3-chloro-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(/C=C/c1cccc2ccccc12)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H15ClN2O2S/c23-20-17-10-3-4-11-18(17)28-21(20)22(27)25-24-19(26)13-12-15-8-5-7-14-6-1-2-9-16(14)15/h1-13H,(H,24,26)(H,25,27)/b13-12+ |
| InChIKey | UZVOFGFMMZGSDE-OUKQBFOZSA-N |
| XLogP | 5.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|