C22H23ClN2OS — CID 35577406
3-chloro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]-1-benzothiophene-2-carboxamide (PubChem CID 35577406) has the molecular formula C22H23ClN2OS and a molecular weight of 398.96 g/mol. Its IUPAC name is 3-chloro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 35577406 |
| Molecular Formula | C22H23ClN2OS |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-chloro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC[C@H](c1ccccc1)N1CCCCC1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H23ClN2OS/c23-20-17-11-5-6-12-19(17)27-21(20)22(26)24-15-18(16-9-3-1-4-10-16)25-13-7-2-8-14-25/h1,3-6,9-12,18H,2,7-8,13-15H2,(H,24,26)/t18-/m1/s1 |
| InChIKey | LTSHZIQVZSOVCT-GOSISDBHSA-N |
| XLogP | 5.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |