C19H19ClN2O2S2 — CID 24652549
3-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 24652549) has the molecular formula C19H19ClN2O2S2 and a molecular weight of 406.96 g/mol. Its IUPAC name is 3-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24652549 |
| Molecular Formula | C19H19ClN2O2S2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC(c1cccs1)N1CCOCC1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C19H19ClN2O2S2/c20-17-13-4-1-2-5-15(13)26-18(17)19(23)21-12-14(16-6-3-11-25-16)22-7-9-24-10-8-22/h1-6,11,14H,7-10,12H2,(H,21,23) |
| InChIKey | OWDMLSPJTZDFAU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |