C19H17ClN2O3S — CID 17218930
3-chloro-N-[3-(2-methoxyethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 17218930) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is 3-chloro-N-[3-(2-methoxyethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-(2-methoxyethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17218930 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 3-chloro-N-[3-(2-methoxyethylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1cccc(NC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O3S/c1-25-10-9-21-18(23)12-5-4-6-13(11-12)22-19(24)17-16(20)14-7-2-3-8-15(14)26-17/h2-8,11H,9-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | VKZBQOMTPFEYOQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|