C23H17ClN2O2S — CID 1348159
N-(3-benzamido-4-methylphenyl)-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 1348159) has the molecular formula C23H17ClN2O2S and a molecular weight of 420.92 g/mol. Its IUPAC name is N-(3-benzamido-4-methylphenyl)-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3-benzamido-4-methylphenyl)-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1348159 |
| Molecular Formula | C23H17ClN2O2S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-(3-benzamido-4-methylphenyl)-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sc3ccccc3c2Cl)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H17ClN2O2S/c1-14-11-12-16(13-18(14)26-22(27)15-7-3-2-4-8-15)25-23(28)21-20(24)17-9-5-6-10-19(17)29-21/h2-13H,1H3,(H,25,28)(H,26,27) |
| InChIKey | CHRBDVWRXBTQSE-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |