C19H13ClN2OS — CID 14906132
3-chloro-N-(2-methylquinolin-4-yl)-1-benzothiophene-2-carboxamide (PubChem CID 14906132) has the molecular formula C19H13ClN2OS and a molecular weight of 352.85 g/mol. Its IUPAC name is 3-chloro-N-(2-methylquinolin-4-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(2-methylquinolin-4-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 14906132 |
| Molecular Formula | C19H13ClN2OS |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-chloro-N-(2-methylquinolin-4-yl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2sc3ccccc3c2Cl)c2ccccc2n1 |
| InChI | InChI=1S/C19H13ClN2OS/c1-11-10-15(12-6-2-4-8-14(12)21-11)22-19(23)18-17(20)13-7-3-5-9-16(13)24-18/h2-10H,1H3,(H,21,22,23) |
| InChIKey | KRQHKEQSGHORHK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |