C15H10ClIN2OS — CID 2212200
3-chloro-N-(5-iodo-6-methyl-2-pyridinyl)-1-benzothiophene-2-carboxamide (PubChem CID 2212200) has the molecular formula C15H10ClIN2OS and a molecular weight of 428.68 g/mol. Its IUPAC name is 3-chloro-N-(5-iodo-6-methyl-2-pyridinyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(5-iodo-6-methyl-2-pyridinyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2212200 |
| Molecular Formula | C15H10ClIN2OS |
| Molecular Weight | 428.68 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 3-chloro-N-(5-iodo-6-methyl-2-pyridinyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nc(NC(=O)c2sc3ccccc3c2Cl)ccc1I |
| InChI | InChI=1S/C15H10ClIN2OS/c1-8-10(17)6-7-12(18-8)19-15(20)14-13(16)9-4-2-3-5-11(9)21-14/h2-7H,1H3,(H,18,19,20) |
| InChIKey | UOLWFARAHLAIGA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|