C20H19N3O3S — CID 21041698
5-methyl-N-[[3-[(1S)-1-phenylethoxy]phenyl]carbamothioyl]-1,2-oxazole-3-carboxamide (PubChem CID 21041698) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 5-methyl-N-[[3-[(1S)-1-phenylethoxy]phenyl]carbamothioyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[[3-[(1S)-1-phenylethoxy]phenyl]carbamothioyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 21041698 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 5-methyl-N-[[3-[(1S)-1-phenylethoxy]phenyl]carbamothioyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(=S)Nc2cccc(O[C@@H](C)c3ccccc3)c2)no1 |
| InChI | InChI=1S/C20H19N3O3S/c1-13-11-18(23-26-13)19(24)22-20(27)21-16-9-6-10-17(12-16)25-14(2)15-7-4-3-5-8-15/h3-12,14H,1-2H3,(H2,21,22,24,27)/t14-/m0/s1 |
| InChIKey | RNELJGSHAOWKLB-AWEZNQCLSA-N |
| XLogP | 4.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|