C21H23N3O3S — CID 142899413
3,5-dimethyl-N-[(3-phenoxyphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide;ethane (PubChem CID 142899413) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(3-phenoxyphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide;ethane.
| Compound Name | 3,5-dimethyl-N-[(3-phenoxyphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide;ethane |
|---|---|
| PubChem CID | 142899413 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3,5-dimethyl-N-[(3-phenoxyphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide;ethane |
| SMILES | CC.Cc1noc(C)c1C(=O)NC(=S)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H17N3O3S.C2H6/c1-12-17(13(2)25-22-12)18(23)21-19(26)20-14-7-6-10-16(11-14)24-15-8-4-3-5-9-15;1-2/h3-11H,1-2H3,(H2,20,21,23,26);1-2H3 |
| InChIKey | NSOPUJQFTAAAME-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|