C18H16N4O2S — CID 89214030
3,5-dimethyl-N-[(3-pyridin-3-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide (PubChem CID 89214030) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(3-pyridin-3-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-[(3-pyridin-3-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 89214030 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 3,5-dimethyl-N-[(3-pyridin-3-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NC(=S)Nc1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C18H16N4O2S/c1-11-16(12(2)24-22-11)17(23)21-18(25)20-15-7-3-5-13(9-15)14-6-4-8-19-10-14/h3-10H,1-2H3,(H2,20,21,23,25) |
| InChIKey | WVDQNJVOQGZCSG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|