C12H13N3O2 — CID 53015749
N-ethyl-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide (PubChem CID 53015749) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-ethyl-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-ethyl-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53015749 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-ethyl-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
| SMILES | CCNC(=O)c1c(-c2cccnc2)noc1C |
| InChI | InChI=1S/C12H13N3O2/c1-3-14-12(16)10-8(2)17-15-11(10)9-5-4-6-13-7-9/h4-7H,3H2,1-2H3,(H,14,16) |
| InChIKey | BMLROMZOWSIGSW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |