C22H25N3O3 — CID 166193213
N-[2-(4-tert-butylphenoxy)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide (PubChem CID 166193213) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166193213 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2cccnc2)c1C(=O)NCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-15-19(20(25-28-15)16-6-5-11-23-14-16)21(26)24-12-13-27-18-9-7-17(8-10-18)22(2,3)4/h5-11,14H,12-13H2,1-4H3,(H,24,26) |
| InChIKey | WRLWZWGZVNWKJA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|