C18H21N3O2 — CID 53001840
N-[2-(cyclohexen-1-yl)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide (PubChem CID 53001840) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53001840 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-methyl-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2cccnc2)c1C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H21N3O2/c1-13-16(17(21-23-13)15-8-5-10-19-12-15)18(22)20-11-9-14-6-3-2-4-7-14/h5-6,8,10,12H,2-4,7,9,11H2,1H3,(H,20,22) |
| InChIKey | FHTLZNFSJDYYKZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|