C23H17N5O2S — CID 25174029
N-[(3-phenoxyphenyl)carbamothioyl]-5-pyrimidin-5-ylpyridine-3-carboxamide (PubChem CID 25174029) has the molecular formula C23H17N5O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[(3-phenoxyphenyl)carbamothioyl]-5-pyrimidin-5-ylpyridine-3-carboxamide.
| Compound Name | N-[(3-phenoxyphenyl)carbamothioyl]-5-pyrimidin-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 25174029 |
| Molecular Formula | C23H17N5O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[(3-phenoxyphenyl)carbamothioyl]-5-pyrimidin-5-ylpyridine-3-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(Oc2ccccc2)c1)c1cncc(-c2cncnc2)c1 |
| InChI | InChI=1S/C23H17N5O2S/c29-22(17-9-16(11-24-12-17)18-13-25-15-26-14-18)28-23(31)27-19-5-4-8-21(10-19)30-20-6-2-1-3-7-20/h1-15H,(H2,27,28,29,31) |
| InChIKey | MNIJNVUWYKHGMZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|