C17H10BrN3O2S — CID 3874219
4-(1,3-benzothiazol-2-yliminomethyl)-2-(2-bromophenyl)-1,3-oxazol-5-ol (PubChem CID 3874219) has the molecular formula C17H10BrN3O2S and a molecular weight of 400.26 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yliminomethyl)-2-(2-bromophenyl)-1,3-oxazol-5-ol.
| Compound Name | 4-(1,3-benzothiazol-2-yliminomethyl)-2-(2-bromophenyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 3874219 |
| Molecular Formula | C17H10BrN3O2S |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yliminomethyl)-2-(2-bromophenyl)-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccccc2Br)nc1C=Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H10BrN3O2S/c18-11-6-2-1-5-10(11)15-20-13(16(22)23-15)9-19-17-21-12-7-3-4-8-14(12)24-17/h1-9,22H |
| InChIKey | DVYHVAUAXBDBCC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|