C20H17N3O4S — CID 3681797
4-[(6-ethoxy-1,3-benzothiazol-2-yl)iminomethyl]-2-(3-methoxyphenyl)-1,3-oxazol-5-ol (PubChem CID 3681797) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-[(6-ethoxy-1,3-benzothiazol-2-yl)iminomethyl]-2-(3-methoxyphenyl)-1,3-oxazol-5-ol.
| Compound Name | 4-[(6-ethoxy-1,3-benzothiazol-2-yl)iminomethyl]-2-(3-methoxyphenyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 3681797 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[(6-ethoxy-1,3-benzothiazol-2-yl)iminomethyl]-2-(3-methoxyphenyl)-1,3-oxazol-5-ol |
| SMILES | CCOc1ccc2nc(N=Cc3nc(-c4cccc(OC)c4)oc3O)sc2c1 |
| InChI | InChI=1S/C20H17N3O4S/c1-3-26-14-7-8-15-17(10-14)28-20(23-15)21-11-16-19(24)27-18(22-16)12-5-4-6-13(9-12)25-2/h4-11,24H,3H2,1-2H3 |
| InChIKey | BQROQQYOKKFIKR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 89.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|