C16H16N2O3S — CID 23828703
N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[5-(methoxymethyl)furan-2-yl]methanimine (PubChem CID 23828703) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[5-(methoxymethyl)furan-2-yl]methanimine.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[5-(methoxymethyl)furan-2-yl]methanimine |
|---|---|
| PubChem CID | 23828703 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[5-(methoxymethyl)furan-2-yl]methanimine |
| SMILES | CCOc1ccc2nc(N=Cc3ccc(COC)o3)sc2c1 |
| InChI | InChI=1S/C16H16N2O3S/c1-3-20-11-6-7-14-15(8-11)22-16(18-14)17-9-12-4-5-13(21-12)10-19-2/h4-9H,3,10H2,1-2H3 |
| InChIKey | LGYOTZIVXYEDAR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|