About 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol
2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol (PubChem CID 137235106) has the molecular formula C16H12N2O2S
and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol.
Molecular Properties
| Compound Name | 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol |
| PubChem CID | 137235106 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccccc2)nc1/C=N/c1ccc(S)cc1 |
| InChI | InChI=1S/C16H12N2O2S/c19-16-14(10-17-12-6-8-13(21)9-7-12)18-15(20-16)11-4-2-1-3-5-11/h1-10,19,21H/b17-10+ |
| InChIKey | UNGIXTMJTFDJPK-LICLKQGHSA-N |
| XLogP | 4.09 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol?
The IUPAC name of 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol (CID 137235106) is 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol.
What is the SMILES notation for 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol?
The canonical SMILES for 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol is Oc1oc(-c2ccccc2)nc1/C=N/c1ccc(S)cc1.
What is the InChIKey of 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol?
The InChIKey is UNGIXTMJTFDJPK-LICLKQGHSA-N. The full InChI is InChI=1S/C16H12N2O2S/c19-16-14(10-17-12-6-8-13(21)9-7-12)18-15(20-16)11-4-2-1-3-5-11/h1-10,19,21H/b17-10+.
What are the key properties of 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol?
2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol has a molecular weight of 296.35 g/mol, XLogP of 4.09, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-[(4-sulfanylphenyl)iminomethyl]-1,3-oxazol-5-ol is sourced from PubChem (CID 137235106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).