C18H13N3O5 — CID 4109891
1-[4-[[5-hydroxy-2-(4-nitrophenyl)-1,3-oxazol-4-yl]methylideneamino]phenyl]ethanone (PubChem CID 4109891) has the molecular formula C18H13N3O5 and a molecular weight of 351.32 g/mol. Its IUPAC name is 1-[4-[[5-hydroxy-2-(4-nitrophenyl)-1,3-oxazol-4-yl]methylideneamino]phenyl]ethanone.
| Compound Name | 1-[4-[[5-hydroxy-2-(4-nitrophenyl)-1,3-oxazol-4-yl]methylideneamino]phenyl]ethanone |
|---|---|
| PubChem CID | 4109891 |
| Molecular Formula | C18H13N3O5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-[4-[[5-hydroxy-2-(4-nitrophenyl)-1,3-oxazol-4-yl]methylideneamino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/N=C/c2nc(-c3ccc([N+](=O)[O-])cc3)oc2O)cc1 |
| InChI | InChI=1S/C18H13N3O5/c1-11(22)12-2-6-14(7-3-12)19-10-16-18(23)26-17(20-16)13-4-8-15(9-5-13)21(24)25/h2-10,23H,1H3/b19-10+ |
| InChIKey | KSXPCEYOFHDMFI-VXLYETTFSA-N |
| XLogP | 3.91 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|