C16H10BrN3O4 — CID 5006778
4-[(4-bromophenyl)iminomethyl]-2-(4-nitrophenyl)-1,3-oxazol-5-ol (PubChem CID 5006778) has the molecular formula C16H10BrN3O4 and a molecular weight of 388.18 g/mol. Its IUPAC name is 4-[(4-bromophenyl)iminomethyl]-2-(4-nitrophenyl)-1,3-oxazol-5-ol.
| Compound Name | 4-[(4-bromophenyl)iminomethyl]-2-(4-nitrophenyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 5006778 |
| Molecular Formula | C16H10BrN3O4 |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 4-[(4-bromophenyl)iminomethyl]-2-(4-nitrophenyl)-1,3-oxazol-5-ol |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(/C=N/c3ccc(Br)cc3)c(O)o2)cc1 |
| InChI | InChI=1S/C16H10BrN3O4/c17-11-3-5-12(6-4-11)18-9-14-16(21)24-15(19-14)10-1-7-13(8-2-10)20(22)23/h1-9,21H/b18-9+ |
| InChIKey | FDOWZZGLQCCNOI-GIJQJNRQSA-N |
| XLogP | 4.47 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|