C13H8BrN3O2S — CID 135614191
2-(4-bromophenyl)-4-[(E)-1,3-thiazol-2-yliminomethyl]-1,3-oxazol-5-ol (PubChem CID 135614191) has the molecular formula C13H8BrN3O2S and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(E)-1,3-thiazol-2-yliminomethyl]-1,3-oxazol-5-ol.
| Compound Name | 2-(4-bromophenyl)-4-[(E)-1,3-thiazol-2-yliminomethyl]-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 135614191 |
| Molecular Formula | C13H8BrN3O2S |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(E)-1,3-thiazol-2-yliminomethyl]-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccc(Br)cc2)nc1/C=N/c1nccs1 |
| InChI | InChI=1S/C13H8BrN3O2S/c14-9-3-1-8(2-4-9)11-17-10(12(18)19-11)7-16-13-15-5-6-20-13/h1-7,18H/b16-7+ |
| InChIKey | IEGUNIIBOSIBHL-FRKPEAEDSA-N |
| XLogP | 4.02 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|