C10H6Br2N2OS — CID 135688989
2,4-dibromo-6-[(E)-1,3-thiazol-2-yliminomethyl]phenol (PubChem CID 135688989) has the molecular formula C10H6Br2N2OS and a molecular weight of 362.05 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-1,3-thiazol-2-yliminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(E)-1,3-thiazol-2-yliminomethyl]phenol |
|---|---|
| PubChem CID | 135688989 |
| Molecular Formula | C10H6Br2N2OS |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.86 |
| IUPAC Name | 2,4-dibromo-6-[(E)-1,3-thiazol-2-yliminomethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/c1nccs1 |
| InChI | InChI=1S/C10H6Br2N2OS/c11-7-3-6(9(15)8(12)4-7)5-14-10-13-1-2-16-10/h1-5,15H/b14-5+ |
| InChIKey | CACIMWISSBWLGE-LHHJGKSTSA-N |
| XLogP | 4.12 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|