C16H17NO4 — CID 135470572
ethyl 3-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate (PubChem CID 135470572) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl 3-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate.
| Compound Name | ethyl 3-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 135470572 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl 3-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C/C2=C(O)CCCC2=O)c1 |
| InChI | InChI=1S/C16H17NO4/c1-2-21-16(20)11-5-3-6-12(9-11)17-10-13-14(18)7-4-8-15(13)19/h3,5-6,9-10,18H,2,4,7-8H2,1H3/b17-10+ |
| InChIKey | ZMRAPQUNQABZER-LICLKQGHSA-N |
| XLogP | 3.13 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|