C23H31NO4 — CID 135721292
nonyl 4-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate (PubChem CID 135721292) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is nonyl 4-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate.
| Compound Name | nonyl 4-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 135721292 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | nonyl 4-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]benzoate |
| SMILES | CCCCCCCCCOC(=O)c1ccc(/N=C/C2=C(O)CCCC2=O)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-2-3-4-5-6-7-8-16-28-23(27)18-12-14-19(15-13-18)24-17-20-21(25)10-9-11-22(20)26/h12-15,17,25H,2-11,16H2,1H3/b24-17+ |
| InChIKey | BHOXIHURAZKLOS-JJIBRWJFSA-N |
| XLogP | 5.86 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|