C24H33NO4 — CID 57042355
decyl 4-[(2,6-dioxocyclohexyl)methylideneamino]benzoate (PubChem CID 57042355) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is decyl 4-[(2,6-dioxocyclohexyl)methylideneamino]benzoate.
| Compound Name | decyl 4-[(2,6-dioxocyclohexyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 57042355 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | decyl 4-[(2,6-dioxocyclohexyl)methylideneamino]benzoate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(/N=C/C2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C24H33NO4/c1-2-3-4-5-6-7-8-9-17-29-24(28)19-13-15-20(16-14-19)25-18-21-22(26)11-10-12-23(21)27/h13-16,18,21H,2-12,17H2,1H3/b25-18+ |
| InChIKey | TYLRAHSARXHAOQ-XIEYBQDHSA-N |
| XLogP | 5.62 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|