C23H31NO4 — CID 57288329
pentyl 4-[(4,4-diethyl-2,6-dioxocyclohexyl)methylideneamino]benzoate (PubChem CID 57288329) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is pentyl 4-[(4,4-diethyl-2,6-dioxocyclohexyl)methylideneamino]benzoate.
| Compound Name | pentyl 4-[(4,4-diethyl-2,6-dioxocyclohexyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 57288329 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | pentyl 4-[(4,4-diethyl-2,6-dioxocyclohexyl)methylideneamino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(/N=C/C2C(=O)CC(CC)(CC)CC2=O)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-4-7-8-13-28-22(27)17-9-11-18(12-10-17)24-16-19-20(25)14-23(5-2,6-3)15-21(19)26/h9-12,16,19H,4-8,13-15H2,1-3H3/b24-16+ |
| InChIKey | SUMJSIQNGOTCFV-LFVJCYFKSA-N |
| XLogP | 5.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|