C22H16N2O6 — CID 177444006
bis[(E)-(2-hydroxyphenyl)methylideneamino] benzene-1,3-dicarboxylate (PubChem CID 177444006) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is bis[(E)-(2-hydroxyphenyl)methylideneamino] benzene-1,3-dicarboxylate.
| Compound Name | bis[(E)-(2-hydroxyphenyl)methylideneamino] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 177444006 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | bis[(E)-(2-hydroxyphenyl)methylideneamino] benzene-1,3-dicarboxylate |
| SMILES | O=C(O/N=C/c1ccccc1O)c1cccc(C(=O)O/N=C/c2ccccc2O)c1 |
| InChI | InChI=1S/C22H16N2O6/c25-19-10-3-1-6-17(19)13-23-29-21(27)15-8-5-9-16(12-15)22(28)30-24-14-18-7-2-4-11-20(18)26/h1-14,25-26H/b23-13+,24-14+ |
| InChIKey | TYVFLCNVNNMIIH-RNIAWFEPSA-N |
| XLogP | 3.48 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|