C21H23N4O5- — CID 7105489
2-methoxy-4-nitro-6-[[4-(4-propanoylpiperazin-1-yl)phenyl]iminomethyl]phenolate (PubChem CID 7105489) has the molecular formula C21H23N4O5- and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-methoxy-4-nitro-6-[[4-(4-propanoylpiperazin-1-yl)phenyl]iminomethyl]phenolate.
| Compound Name | 2-methoxy-4-nitro-6-[[4-(4-propanoylpiperazin-1-yl)phenyl]iminomethyl]phenolate |
|---|---|
| PubChem CID | 7105489 |
| Molecular Formula | C21H23N4O5- |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-methoxy-4-nitro-6-[[4-(4-propanoylpiperazin-1-yl)phenyl]iminomethyl]phenolate |
| SMILES | CCC(=O)N1CCN(c2ccc(/N=C/c3cc([N+](=O)[O-])cc(OC)c3[O-])cc2)CC1 |
| InChI | InChI=1S/C21H24N4O5/c1-3-20(26)24-10-8-23(9-11-24)17-6-4-16(5-7-17)22-14-15-12-18(25(28)29)13-19(30-2)21(15)27/h4-7,12-14,27H,3,8-11H2,1-2H3/p-1/b22-14+ |
| InChIKey | GTPZXCFXACFNPQ-HYARGMPZSA-M |
| XLogP | 2.49 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|