C21H26N5O4+ — CID 7122998
3-(2-hydroxyphenyl)-N-[(Z)-[2-(4-methylpiperazin-4-ium-1-yl)-5-nitrophenyl]methylideneamino]propanamide (PubChem CID 7122998) has the molecular formula C21H26N5O4+ and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-N-[(Z)-[2-(4-methylpiperazin-4-ium-1-yl)-5-nitrophenyl]methylideneamino]propanamide.
| Compound Name | 3-(2-hydroxyphenyl)-N-[(Z)-[2-(4-methylpiperazin-4-ium-1-yl)-5-nitrophenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 7122998 |
| Molecular Formula | C21H26N5O4+ |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-(2-hydroxyphenyl)-N-[(Z)-[2-(4-methylpiperazin-4-ium-1-yl)-5-nitrophenyl]methylideneamino]propanamide |
| SMILES | C[NH+]1CCN(c2ccc([N+](=O)[O-])cc2/C=N\NC(=O)CCc2ccccc2O)CC1 |
| InChI | InChI=1S/C21H25N5O4/c1-24-10-12-25(13-11-24)19-8-7-18(26(29)30)14-17(19)15-22-23-21(28)9-6-16-4-2-3-5-20(16)27/h2-5,7-8,14-15,27H,6,9-13H2,1H3,(H,23,28)/p+1/b22-15- |
| InChIKey | LYSAVHMHJSGDGL-JCMHNJIXSA-O |
| XLogP | 0.72 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|