C11H18N4O4S — CID 6251262
(4E)-4-[[(Z)-4-carboxybutan-2-ylideneamino]carbamothioylhydrazinylidene]pentanoic acid (PubChem CID 6251262) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is (4E)-4-[[(Z)-4-carboxybutan-2-ylideneamino]carbamothioylhydrazinylidene]pentanoic acid.
| Compound Name | (4E)-4-[[(Z)-4-carboxybutan-2-ylideneamino]carbamothioylhydrazinylidene]pentanoic acid |
|---|---|
| PubChem CID | 6251262 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (4E)-4-[[(Z)-4-carboxybutan-2-ylideneamino]carbamothioylhydrazinylidene]pentanoic acid |
| SMILES | C/C(CCC(=O)O)=N/NC(=S)N/N=C(\C)CCC(=O)O |
| InChI | InChI=1S/C11H18N4O4S/c1-7(3-5-9(16)17)12-14-11(20)15-13-8(2)4-6-10(18)19/h3-6H2,1-2H3,(H,16,17)(H,18,19)(H2,14,15,20)/b12-7-,13-8+ |
| InChIKey | YFTWBRKYFXQICM-HAKHBUOSSA-N |
| XLogP | 0.93 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|