C12H12N4O7 — CID 121015453
(2Z)-2-[(4-nitrophenyl)carbamoylhydrazinylidene]pentanedioic acid (PubChem CID 121015453) has the molecular formula C12H12N4O7 and a molecular weight of 324.25 g/mol. Its IUPAC name is (2Z)-2-[(4-nitrophenyl)carbamoylhydrazinylidene]pentanedioic acid.
| Compound Name | (2Z)-2-[(4-nitrophenyl)carbamoylhydrazinylidene]pentanedioic acid |
|---|---|
| PubChem CID | 121015453 |
| Molecular Formula | C12H12N4O7 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (2Z)-2-[(4-nitrophenyl)carbamoylhydrazinylidene]pentanedioic acid |
| SMILES | O=C(O)CC/C(=N/NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C12H12N4O7/c17-10(18)6-5-9(11(19)20)14-15-12(21)13-7-1-3-8(4-2-7)16(22)23/h1-4H,5-6H2,(H,17,18)(H,19,20)(H2,13,15,21)/b14-9- |
| InChIKey | YNSORHGIYBRBNW-ZROIWOOFSA-N |
| XLogP | 1.02 |
| TPSA | 171.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|