C13H25N7OS2 — CID 162740752
1-ethyl-3-[(E)-[(1E)-1-(ethylcarbamothioylhydrazinylidene)-1-morpholin-2-ylpropan-2-ylidene]amino]thiourea (PubChem CID 162740752) has the molecular formula C13H25N7OS2 and a molecular weight of 359.53 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-[(1E)-1-(ethylcarbamothioylhydrazinylidene)-1-morpholin-2-ylpropan-2-ylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-[(1E)-1-(ethylcarbamothioylhydrazinylidene)-1-morpholin-2-ylpropan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 162740752 |
| Molecular Formula | C13H25N7OS2 |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-ethyl-3-[(E)-[(1E)-1-(ethylcarbamothioylhydrazinylidene)-1-morpholin-2-ylpropan-2-ylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C(C)/C(=N\NC(=S)NCC)C1CNCCO1 |
| InChI | InChI=1S/C13H25N7OS2/c1-4-15-12(22)19-17-9(3)11(10-8-14-6-7-21-10)18-20-13(23)16-5-2/h10,14H,4-8H2,1-3H3,(H2,15,19,22)(H2,16,20,23)/b17-9+,18-11+ |
| InChIKey | PRPIRGUELYZACV-XURGJTJWSA-N |
| XLogP | -0.33 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|