C14H27N7O3S3 — CID 162740764
1-ethyl-3-[(Z)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-(4-methylsulfonylmorpholin-2-yl)propan-2-ylidene]amino]thiourea (PubChem CID 162740764) has the molecular formula C14H27N7O3S3 and a molecular weight of 437.62 g/mol. Its IUPAC name is 1-ethyl-3-[(Z)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-(4-methylsulfonylmorpholin-2-yl)propan-2-ylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[(Z)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-(4-methylsulfonylmorpholin-2-yl)propan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 162740764 |
| Molecular Formula | C14H27N7O3S3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 1-ethyl-3-[(Z)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-(4-methylsulfonylmorpholin-2-yl)propan-2-ylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C(C)\C(=N\NC(=S)NCC)C1CN(S(C)(=O)=O)CCO1 |
| InChI | InChI=1S/C14H27N7O3S3/c1-5-15-13(25)19-17-10(3)12(18-20-14(26)16-6-2)11-9-21(7-8-24-11)27(4,22)23/h11H,5-9H2,1-4H3,(H2,15,19,25)(H2,16,20,26)/b17-10-,18-12- |
| InChIKey | RZYQCDCSTPVEMH-NGEVDRGDSA-N |
| XLogP | -0.65 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|