C9H16N2O5S2 — CID 79680830
methyl 3-(2-carbamothioylmorpholin-4-yl)sulfonylpropanoate (PubChem CID 79680830) has the molecular formula C9H16N2O5S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 3-(2-carbamothioylmorpholin-4-yl)sulfonylpropanoate.
| Compound Name | methyl 3-(2-carbamothioylmorpholin-4-yl)sulfonylpropanoate |
|---|---|
| PubChem CID | 79680830 |
| Molecular Formula | C9H16N2O5S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | methyl 3-(2-carbamothioylmorpholin-4-yl)sulfonylpropanoate |
| SMILES | COC(=O)CCS(=O)(=O)N1CCOC(C(N)=S)C1 |
| InChI | InChI=1S/C9H16N2O5S2/c1-15-8(12)2-5-18(13,14)11-3-4-16-7(6-11)9(10)17/h7H,2-6H2,1H3,(H2,10,17) |
| InChIKey | MVZHVYSINLSYIX-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|