C10H18N2O5S2 — CID 79675025
methyl 4-(2-carbamothioylmorpholin-4-yl)sulfonylbutanoate (PubChem CID 79675025) has the molecular formula C10H18N2O5S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is methyl 4-(2-carbamothioylmorpholin-4-yl)sulfonylbutanoate.
| Compound Name | methyl 4-(2-carbamothioylmorpholin-4-yl)sulfonylbutanoate |
|---|---|
| PubChem CID | 79675025 |
| Molecular Formula | C10H18N2O5S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | methyl 4-(2-carbamothioylmorpholin-4-yl)sulfonylbutanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N1CCOC(C(N)=S)C1 |
| InChI | InChI=1S/C10H18N2O5S2/c1-16-9(13)3-2-6-19(14,15)12-4-5-17-8(7-12)10(11)18/h8H,2-7H2,1H3,(H2,11,18) |
| InChIKey | QBKVQZGDSNYEPY-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|