C6H13N3O4S — CID 86767791
4-methylsulfonylmorpholine-2-carbohydrazide (PubChem CID 86767791) has the molecular formula C6H13N3O4S and a molecular weight of 223.25 g/mol. Its IUPAC name is 4-methylsulfonylmorpholine-2-carbohydrazide.
| Compound Name | 4-methylsulfonylmorpholine-2-carbohydrazide |
|---|---|
| PubChem CID | 86767791 |
| Molecular Formula | C6H13N3O4S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-methylsulfonylmorpholine-2-carbohydrazide |
| SMILES | CS(=O)(=O)N1CCOC(C(=O)NN)C1 |
| InChI | InChI=1S/C6H13N3O4S/c1-14(11,12)9-2-3-13-5(4-9)6(10)8-7/h5H,2-4,7H2,1H3,(H,8,10) |
| InChIKey | MAJJLAGICSPVOM-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|