C12H23N3O4S — CID 49460924
4-(3,5-dimethylpiperidin-1-yl)sulfonylmorpholine-2-carboxamide (PubChem CID 49460924) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonylmorpholine-2-carboxamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 49460924 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonylmorpholine-2-carboxamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)N2CCOC(C(N)=O)C2)C1 |
| InChI | InChI=1S/C12H23N3O4S/c1-9-5-10(2)7-15(6-9)20(17,18)14-3-4-19-11(8-14)12(13)16/h9-11H,3-8H2,1-2H3,(H2,13,16) |
| InChIKey | ZOVDBDJAIVVNEY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |