C6H13N3O2 — CID 123261684
4-(methylamino)morpholine-2-carboxamide (PubChem CID 123261684) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 4-(methylamino)morpholine-2-carboxamide.
| Compound Name | 4-(methylamino)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 123261684 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 4-(methylamino)morpholine-2-carboxamide |
| SMILES | CNN1CCOC(C(N)=O)C1 |
| InChI | InChI=1S/C6H13N3O2/c1-8-9-2-3-11-5(4-9)6(7)10/h5,8H,2-4H2,1H3,(H2,7,10) |
| InChIKey | QWOPPYLQPNZBKD-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |