C6H14N2O — CID 123740948
N,2-dimethylmorpholin-4-amine (PubChem CID 123740948) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is N,2-dimethylmorpholin-4-amine.
| Compound Name | N,2-dimethylmorpholin-4-amine |
|---|---|
| PubChem CID | 123740948 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | N,2-dimethylmorpholin-4-amine |
| SMILES | CNN1CCOC(C)C1 |
| InChI | InChI=1S/C6H14N2O/c1-6-5-8(7-2)3-4-9-6/h6-7H,3-5H2,1-2H3 |
| InChIKey | BLILYDUMQQSINV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |