C7H14N2O4 — CID 174387673
4-(1,2-dihydroxyethyl)morpholine-2-carboxamide (PubChem CID 174387673) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-(1,2-dihydroxyethyl)morpholine-2-carboxamide.
| Compound Name | 4-(1,2-dihydroxyethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 174387673 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-(1,2-dihydroxyethyl)morpholine-2-carboxamide |
| SMILES | NC(=O)C1CN(C(O)CO)CCO1 |
| InChI | InChI=1S/C7H14N2O4/c8-7(12)5-3-9(1-2-13-5)6(11)4-10/h5-6,10-11H,1-4H2,(H2,8,12) |
| InChIKey | CFSSOXPIVFLHIH-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |