C17H30N4O5S — CID 55558529
1-[4-(3,5-dimethylpiperidin-1-yl)sulfonylpiperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione (PubChem CID 55558529) has the molecular formula C17H30N4O5S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)sulfonylpiperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)sulfonylpiperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55558529 |
| Molecular Formula | C17H30N4O5S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)sulfonylpiperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
| SMILES | CC1CC(C)CN(S(=O)(=O)N2CCN(C(=O)C(=O)N3CCOCC3)CC2)C1 |
| InChI | InChI=1S/C17H30N4O5S/c1-14-11-15(2)13-21(12-14)27(24,25)20-5-3-18(4-6-20)16(22)17(23)19-7-9-26-10-8-19/h14-15H,3-13H2,1-2H3 |
| InChIKey | UXENTZLUFCOVBT-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|