C17H17ClF3NO3 — CID 55535060
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(trifluoromethyl)cyclohexyl]prop-2-enamide (PubChem CID 55535060) has the molecular formula C17H17ClF3NO3 and a molecular weight of 375.77 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(trifluoromethyl)cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(trifluoromethyl)cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 55535060 |
| Molecular Formula | C17H17ClF3NO3 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(trifluoromethyl)cyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H17ClF3NO3/c18-13-6-10(7-14-16(13)25-9-24-14)4-5-15(23)22-12-3-1-2-11(8-12)17(19,20)21/h4-7,11-12H,1-3,8-9H2,(H,22,23)/b5-4+ |
| InChIKey | RYCLFCBNNICADU-SNAWJCMRSA-N |
| XLogP | 4.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|