C18H21ClF2N2O3 — CID 49074153
(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]prop-2-enamide (PubChem CID 49074153) has the molecular formula C18H21ClF2N2O3 and a molecular weight of 386.83 g/mol. Its IUPAC name is (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 49074153 |
| Molecular Formula | C18H21ClF2N2O3 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C18H21ClF2N2O3/c19-14-9-12(10-15-18(14)26-8-7-25-15)1-2-17(24)22-13-3-5-23(6-4-13)11-16(20)21/h1-2,9-10,13,16H,3-8,11H2,(H,22,24)/b2-1+ |
| InChIKey | GKUZPZIJQBXRFZ-OWOJBTEDSA-N |
| XLogP | 2.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|