C20H21ClN4O4 — CID 49055329
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 49055329) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 49055329 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)Nc1cnn(CC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C20H21ClN4O4/c21-16-7-13(8-17-20(16)29-12-28-17)5-6-18(26)24-15-9-22-25(10-15)11-19(27)23-14-3-1-2-4-14/h5-10,14H,1-4,11-12H2,(H,23,27)(H,24,26)/b6-5+ |
| InChIKey | BQMPAPWZJNHODE-AATRIKPKSA-N |
| XLogP | 2.98 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|