C19H15ClFNO3 — CID 67175470
5-[2-(3-chloro-4-fluorophenyl)ethenyl]-2-(cyclopropanecarbonylamino)benzoic acid (PubChem CID 67175470) has the molecular formula C19H15ClFNO3 and a molecular weight of 359.78 g/mol. Its IUPAC name is 5-[2-(3-chloro-4-fluorophenyl)ethenyl]-2-(cyclopropanecarbonylamino)benzoic acid.
| Compound Name | 5-[2-(3-chloro-4-fluorophenyl)ethenyl]-2-(cyclopropanecarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 67175470 |
| Molecular Formula | C19H15ClFNO3 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 5-[2-(3-chloro-4-fluorophenyl)ethenyl]-2-(cyclopropanecarbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(C=Cc2ccc(F)c(Cl)c2)ccc1NC(=O)C1CC1 |
| InChI | InChI=1S/C19H15ClFNO3/c20-15-10-12(3-7-16(15)21)2-1-11-4-8-17(14(9-11)19(24)25)22-18(23)13-5-6-13/h1-4,7-10,13H,5-6H2,(H,22,23)(H,24,25) |
| InChIKey | GVDWHWWDVNWSGA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|