C17H23NO3 — CID 114630620
(E)-3-(4-ethoxyphenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide (PubChem CID 114630620) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide |
|---|---|
| PubChem CID | 114630620 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NC2CC(O)C2(C)C)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-4-21-13-8-5-12(6-9-13)7-10-16(20)18-14-11-15(19)17(14,2)3/h5-10,14-15,19H,4,11H2,1-3H3,(H,18,20)/b10-7+ |
| InChIKey | PERUWEPDRIGDNY-JXMROGBWSA-N |
| XLogP | 2.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|