C10H15NO4 — CID 114628868
(E)-4-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4-oxobut-2-enoic acid (PubChem CID 114628868) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is (E)-4-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 114628868 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (E)-4-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4-oxobut-2-enoic acid |
| SMILES | CC1(C)C(O)CC1NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H15NO4/c1-10(2)6(5-7(10)12)11-8(13)3-4-9(14)15/h3-4,6-7,12H,5H2,1-2H3,(H,11,13)(H,14,15)/b4-3+ |
| InChIKey | CSPKJFFHOHROSA-ONEGZZNKSA-N |
| XLogP | -0.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|