C9H13NO3S — CID 131239479
(Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 131239479) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 131239479 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | CC1(C)SCC1NC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H13NO3S/c1-9(2)6(5-14-9)10-7(11)3-4-8(12)13/h3-4,6H,5H2,1-2H3,(H,10,11)(H,12,13)/b4-3- |
| InChIKey | IPJSVQDNVHANIW-ARJAWSKDSA-N |
| XLogP | 0.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|