(Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid

C9H13NO3S — CID 131239479

IUPAC(Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid
SMILESCC1(C)SCC1NC(=O)/C=C\C(=O)O
InChIInChI=1S/C9H13NO3S/c1-9(2)6(5-14-9)10-7(11)3-4-8(12)13/h3-4,6H,5H2,1-2H3,(H,10,11)(H,12,13)/b4-3-
InChIKeyIPJSVQDNVHANIW-ARJAWSKDSA-N
MW215.27 g/mol
LogP0.64
Rot. Bonds3

About (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid

(Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 131239479) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid
PubChem CID131239479
Molecular FormulaC9H13NO3S
Molecular Weight215.27 g/mol
Exact Mass215.06
IUPAC Name(Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid
SMILESCC1(C)SCC1NC(=O)/C=C\C(=O)O
InChIInChI=1S/C9H13NO3S/c1-9(2)6(5-14-9)10-7(11)3-4-8(12)13/h3-4,6H,5H2,1-2H3,(H,10,11)(H,12,13)/b4-3-
InChIKeyIPJSVQDNVHANIW-ARJAWSKDSA-N
XLogP0.64
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.27
LogP ≤ 50.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid?
The IUPAC name of (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid (CID 131239479) is (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid?
The canonical SMILES for (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid is CC1(C)SCC1NC(=O)/C=C\C(=O)O.
What is the InChIKey of (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid?
The InChIKey is IPJSVQDNVHANIW-ARJAWSKDSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-9(2)6(5-14-9)10-7(11)3-4-8(12)13/h3-4,6H,5H2,1-2H3,(H,10,11)(H,12,13)/b4-3-.
What are the key properties of (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid?
(Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid has a molecular weight of 215.27 g/mol, XLogP of 0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-[(2,2-dimethylthietan-3-yl)amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 131239479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).